![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| stex-en.ldf | 2023-09-27 13:04 | 3.7K | |
| problem-russian.ldf | 2023-09-13 17:11 | 770 | |
| problem-ngerman.ldf | 2023-09-22 08:50 | 740 | |
| problem-french.ldf | 2023-09-13 17:11 | 793 | |
| problem-finnish.ldf | 2023-09-13 17:11 | 788 | |
| problem-english.ldf | 2023-09-22 08:50 | 414 | |
| hwexam-russian.ldf | 2023-03-20 10:04 | 1.0K | |
| hwexam-ngerman.ldf | 2023-03-20 10:04 | 843 | |
| hwexam-french.ldf | 2023-03-20 10:04 | 814 | |
| hwexam-finnish.ldf | 2023-03-20 10:04 | 866 | |
| hwexam-english.ldf | 2023-03-20 10:04 | 480 | |
| document-structure-ngerman.ldf | 2022-08-24 20:42 | 594 | |